C21H28N4O2 — CID 55704797
1-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-[4-(dimethylamino)-2-methylphenyl]urea (PubChem CID 55704797) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-[4-(dimethylamino)-2-methylphenyl]urea.
| Compound Name | 1-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-[4-(dimethylamino)-2-methylphenyl]urea |
|---|---|
| PubChem CID | 55704797 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-[4-(dimethylamino)-2-methylphenyl]urea |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)NCc1cccnc1OC1CCCC1 |
| InChI | InChI=1S/C21H28N4O2/c1-15-13-17(25(2)3)10-11-19(15)24-21(26)23-14-16-7-6-12-22-20(16)27-18-8-4-5-9-18/h6-7,10-13,18H,4-5,8-9,14H2,1-3H3,(H2,23,24,26) |
| InChIKey | LSJCIROJGSDYDH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|