C17H18BrFN2O4S — CID 55706851
2-[(4-bromophenyl)sulfonyl-methylamino]-N-[2-(3-fluorophenoxy)ethyl]acetamide (PubChem CID 55706851) has the molecular formula C17H18BrFN2O4S and a molecular weight of 445.31 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[2-(3-fluorophenoxy)ethyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[2-(3-fluorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 55706851 |
| Molecular Formula | C17H18BrFN2O4S |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[2-(3-fluorophenoxy)ethyl]acetamide |
| SMILES | CN(CC(=O)NCCOc1cccc(F)c1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrFN2O4S/c1-21(26(23,24)16-7-5-13(18)6-8-16)12-17(22)20-9-10-25-15-4-2-3-14(19)11-15/h2-8,11H,9-10,12H2,1H3,(H,20,22) |
| InChIKey | XYQICPQOZFKCKY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|