C14H19BrN2O5S — CID 46488251
methyl 4-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]amino]butanoate (PubChem CID 46488251) has the molecular formula C14H19BrN2O5S and a molecular weight of 407.29 g/mol. Its IUPAC name is methyl 4-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 46488251 |
| Molecular Formula | C14H19BrN2O5S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | methyl 4-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN(C)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H19BrN2O5S/c1-17(10-13(18)16-9-3-4-14(19)22-2)23(20,21)12-7-5-11(15)6-8-12/h5-8H,3-4,9-10H2,1-2H3,(H,16,18) |
| InChIKey | WPKMUPFEDBBHOD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|