C14H14Br2N2O3S2 — CID 112826372
2-[(4-bromophenyl)sulfonyl-methylamino]-N-[(5-bromothiophen-2-yl)methyl]acetamide (PubChem CID 112826372) has the molecular formula C14H14Br2N2O3S2 and a molecular weight of 482.22 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[(5-bromothiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[(5-bromothiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 112826372 |
| Molecular Formula | C14H14Br2N2O3S2 |
| Molecular Weight | 482.22 g/mol |
| Exact Mass | 479.88 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-[(5-bromothiophen-2-yl)methyl]acetamide |
| SMILES | CN(CC(=O)NCc1ccc(Br)s1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H14Br2N2O3S2/c1-18(23(20,21)12-5-2-10(15)3-6-12)9-14(19)17-8-11-4-7-13(16)22-11/h2-7H,8-9H2,1H3,(H,17,19) |
| InChIKey | NBAKREHYFNKRBW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |