C22H24N2O3 — CID 55707854
N-[(2-ethoxy-4-pyridinyl)methyl]-4-naphthalen-1-yloxybutanamide (PubChem CID 55707854) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[(2-ethoxy-4-pyridinyl)methyl]-4-naphthalen-1-yloxybutanamide.
| Compound Name | N-[(2-ethoxy-4-pyridinyl)methyl]-4-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 55707854 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[(2-ethoxy-4-pyridinyl)methyl]-4-naphthalen-1-yloxybutanamide |
| SMILES | CCOc1cc(CNC(=O)CCCOc2cccc3ccccc23)ccn1 |
| InChI | InChI=1S/C22H24N2O3/c1-2-26-22-15-17(12-13-23-22)16-24-21(25)11-6-14-27-20-10-5-8-18-7-3-4-9-19(18)20/h3-5,7-10,12-13,15H,2,6,11,14,16H2,1H3,(H,24,25) |
| InChIKey | YQGKOYWNKFORFK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|