C24H26N2O5 — CID 39228981
N-[3-[[4-(2-ethoxyphenoxy)butanoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 39228981) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[3-[[4-(2-ethoxyphenoxy)butanoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[4-(2-ethoxyphenoxy)butanoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39228981 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[3-[[4-(2-ethoxyphenoxy)butanoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CCOc1ccccc1OCCCC(=O)NCc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-2-29-20-10-3-4-11-21(20)30-15-7-13-23(27)25-17-18-8-5-9-19(16-18)26-24(28)22-12-6-14-31-22/h3-6,8-12,14,16H,2,7,13,15,17H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | IMWKJMCXPMEWJB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|