C17H21N3O4S — CID 55709594
N-[4-(dimethylamino)-2-methylphenyl]-4-(methoxysulfamoyl)benzamide (PubChem CID 55709594) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methylphenyl]-4-(methoxysulfamoyl)benzamide.
| Compound Name | N-[4-(dimethylamino)-2-methylphenyl]-4-(methoxysulfamoyl)benzamide |
|---|---|
| PubChem CID | 55709594 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-[4-(dimethylamino)-2-methylphenyl]-4-(methoxysulfamoyl)benzamide |
| SMILES | CONS(=O)(=O)c1ccc(C(=O)Nc2ccc(N(C)C)cc2C)cc1 |
| InChI | InChI=1S/C17H21N3O4S/c1-12-11-14(20(2)3)7-10-16(12)18-17(21)13-5-8-15(9-6-13)25(22,23)19-24-4/h5-11,19H,1-4H3,(H,18,21) |
| InChIKey | WAPKBUDAKRNQIV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|