C19H25N3O5S2 — CID 55711315
N-[[2-(methanesulfonamido)phenyl]methyl]-3-[methyl(propan-2-yl)sulfamoyl]benzamide (PubChem CID 55711315) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[[2-(methanesulfonamido)phenyl]methyl]-3-[methyl(propan-2-yl)sulfamoyl]benzamide.
| Compound Name | N-[[2-(methanesulfonamido)phenyl]methyl]-3-[methyl(propan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55711315 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[[2-(methanesulfonamido)phenyl]methyl]-3-[methyl(propan-2-yl)sulfamoyl]benzamide |
| SMILES | CC(C)N(C)S(=O)(=O)c1cccc(C(=O)NCc2ccccc2NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H25N3O5S2/c1-14(2)22(3)29(26,27)17-10-7-9-15(12-17)19(23)20-13-16-8-5-6-11-18(16)21-28(4,24)25/h5-12,14,21H,13H2,1-4H3,(H,20,23) |
| InChIKey | RZLXUICPNXTLQK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |