C23H24N4O3 — CID 55714348
4-methoxy-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 55714348) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-methoxy-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 4-methoxy-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55714348 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-methoxy-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)Nc1cccc(C)c1C(=O)N1CCCC1 |
| InChI | InChI=1S/C23H24N4O3/c1-16-9-8-12-18(20(16)23(29)26-13-6-7-14-26)24-22(28)21-19(30-2)15-27(25-21)17-10-4-3-5-11-17/h3-5,8-12,15H,6-7,13-14H2,1-2H3,(H,24,28) |
| InChIKey | JUKBJRLDAYPTET-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |