C21H28N4O4 — CID 55717388
N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methyl-2-(phenylcarbamoylamino)butanamide (PubChem CID 55717388) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methyl-2-(phenylcarbamoylamino)butanamide.
| Compound Name | N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methyl-2-(phenylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 55717388 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methyl-2-(phenylcarbamoylamino)butanamide |
| SMILES | COCCOc1ncccc1CNC(=O)C(NC(=O)Nc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H28N4O4/c1-15(2)18(25-21(27)24-17-9-5-4-6-10-17)19(26)23-14-16-8-7-11-22-20(16)29-13-12-28-3/h4-11,15,18H,12-14H2,1-3H3,(H,23,26)(H2,24,25,27) |
| InChIKey | JKCZWKJDWIPVMU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|