C27H31N3O3 — CID 55718193
N-pentyl-1-[2-(5-phenyl-1,3-oxazol-2-yl)benzoyl]piperidine-4-carboxamide (PubChem CID 55718193) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-pentyl-1-[2-(5-phenyl-1,3-oxazol-2-yl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-pentyl-1-[2-(5-phenyl-1,3-oxazol-2-yl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55718193 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-pentyl-1-[2-(5-phenyl-1,3-oxazol-2-yl)benzoyl]piperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)c2ccccc2-c2ncc(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C27H31N3O3/c1-2-3-9-16-28-25(31)21-14-17-30(18-15-21)27(32)23-13-8-7-12-22(23)26-29-19-24(33-26)20-10-5-4-6-11-20/h4-8,10-13,19,21H,2-3,9,14-18H2,1H3,(H,28,31) |
| InChIKey | DBMJKBZWGCYLNJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|