C21H28N2O5 — CID 55719061
2-methoxyethyl 2,4-dimethyl-5-[(4-propan-2-yloxyphenyl)methylcarbamoyl]-1H-pyrrole-3-carboxylate (PubChem CID 55719061) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-methoxyethyl 2,4-dimethyl-5-[(4-propan-2-yloxyphenyl)methylcarbamoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 2,4-dimethyl-5-[(4-propan-2-yloxyphenyl)methylcarbamoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55719061 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-methoxyethyl 2,4-dimethyl-5-[(4-propan-2-yloxyphenyl)methylcarbamoyl]-1H-pyrrole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)[nH]c(C(=O)NCc2ccc(OC(C)C)cc2)c1C |
| InChI | InChI=1S/C21H28N2O5/c1-13(2)28-17-8-6-16(7-9-17)12-22-20(24)19-14(3)18(15(4)23-19)21(25)27-11-10-26-5/h6-9,13,23H,10-12H2,1-5H3,(H,22,24) |
| InChIKey | DIYXUNQEKDANNV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|