C21H28N4O5 — CID 46473108
2-methoxyethyl 2,4-dimethyl-5-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoyl]-1H-pyrrole-3-carboxylate (PubChem CID 46473108) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-methoxyethyl 2,4-dimethyl-5-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 2,4-dimethyl-5-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 46473108 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-methoxyethyl 2,4-dimethyl-5-[(2-morpholin-4-yl-4-pyridinyl)methylcarbamoyl]-1H-pyrrole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)[nH]c(C(=O)NCc2ccnc(N3CCOCC3)c2)c1C |
| InChI | InChI=1S/C21H28N4O5/c1-14-18(21(27)30-11-10-28-3)15(2)24-19(14)20(26)23-13-16-4-5-22-17(12-16)25-6-8-29-9-7-25/h4-5,12,24H,6-11,13H2,1-3H3,(H,23,26) |
| InChIKey | OHCZECPZTLKIJV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|