C16H26N4O4 — CID 95134145
1-[(2S)-2-hydroxy-3-methoxypropyl]-1-methyl-3-[(2-morpholin-4-yl-4-pyridinyl)methyl]urea (PubChem CID 95134145) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-3-methoxypropyl]-1-methyl-3-[(2-morpholin-4-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-[(2S)-2-hydroxy-3-methoxypropyl]-1-methyl-3-[(2-morpholin-4-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 95134145 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[(2S)-2-hydroxy-3-methoxypropyl]-1-methyl-3-[(2-morpholin-4-yl-4-pyridinyl)methyl]urea |
| SMILES | COC[C@@H](O)CN(C)C(=O)NCc1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C16H26N4O4/c1-19(11-14(21)12-23-2)16(22)18-10-13-3-4-17-15(9-13)20-5-7-24-8-6-20/h3-4,9,14,21H,5-8,10-12H2,1-2H3,(H,18,22)/t14-/m0/s1 |
| InChIKey | LCQHCQMCTOUCIX-AWEZNQCLSA-N |
| XLogP | 0.07 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |