C19H25F3N2O5S — CID 55719765
3-(oxolan-2-ylmethoxy)-1-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 55719765) has the molecular formula C19H25F3N2O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethoxy)-1-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 3-(oxolan-2-ylmethoxy)-1-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 55719765 |
| Molecular Formula | C19H25F3N2O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 3-(oxolan-2-ylmethoxy)-1-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | O=C(CCOCC1CCCO1)N1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H25F3N2O5S/c20-19(21,22)15-3-1-5-17(13-15)30(26,27)24-9-7-23(8-10-24)18(25)6-12-28-14-16-4-2-11-29-16/h1,3,5,13,16H,2,4,6-12,14H2 |
| InChIKey | RTOCEYGVUWZPDE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|