C17H21F3N2O5S — CID 55595827
1-[4-(3-acetylphenyl)sulfonylpiperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 55595827) has the molecular formula C17H21F3N2O5S and a molecular weight of 422.43 g/mol. Its IUPAC name is 1-[4-(3-acetylphenyl)sulfonylpiperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-[4-(3-acetylphenyl)sulfonylpiperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 55595827 |
| Molecular Formula | C17H21F3N2O5S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[4-(3-acetylphenyl)sulfonylpiperazin-1-yl]-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCN(C(=O)CCOCC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C17H21F3N2O5S/c1-13(23)14-3-2-4-15(11-14)28(25,26)22-8-6-21(7-9-22)16(24)5-10-27-12-17(18,19)20/h2-4,11H,5-10,12H2,1H3 |
| InChIKey | GHXNZHIRMJEIFA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|