C17H19N5O6S — CID 55821870
1-[4-(3-acetylphenyl)sulfonylpiperazin-1-yl]-2-(3-nitropyrazol-1-yl)ethanone (PubChem CID 55821870) has the molecular formula C17H19N5O6S and a molecular weight of 421.44 g/mol. Its IUPAC name is 1-[4-(3-acetylphenyl)sulfonylpiperazin-1-yl]-2-(3-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-[4-(3-acetylphenyl)sulfonylpiperazin-1-yl]-2-(3-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 55821870 |
| Molecular Formula | C17H19N5O6S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-[4-(3-acetylphenyl)sulfonylpiperazin-1-yl]-2-(3-nitropyrazol-1-yl)ethanone |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCN(C(=O)Cn3ccc([N+](=O)[O-])n3)CC2)c1 |
| InChI | InChI=1S/C17H19N5O6S/c1-13(23)14-3-2-4-15(11-14)29(27,28)21-9-7-19(8-10-21)17(24)12-20-6-5-16(18-20)22(25)26/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | REJJHMPPSMFXQH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|