C21H27N5O6S — CID 97001603
(3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 97001603) has the molecular formula C21H27N5O6S and a molecular weight of 477.54 g/mol. Its IUPAC name is (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 97001603 |
| Molecular Formula | C21H27N5O6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | CC(=O)c1c(C)nn([C@H](C)CC(=O)N2CCN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC2)c1C |
| InChI | InChI=1S/C21H27N5O6S/c1-14(25-16(3)21(17(4)27)15(2)22-25)12-20(28)23-8-10-24(11-9-23)33(31,32)19-7-5-6-18(13-19)26(29)30/h5-7,13-14H,8-12H2,1-4H3/t14-/m1/s1 |
| InChIKey | QYIULWIRSZTRBM-CQSZACIVSA-N |
| XLogP | 2.09 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|