C20H28N4O3S — CID 56550483
1-[3-[4-(5-pyrazol-1-ylpentyl)piperazin-1-yl]sulfonylphenyl]ethanone (PubChem CID 56550483) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is 1-[3-[4-(5-pyrazol-1-ylpentyl)piperazin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[3-[4-(5-pyrazol-1-ylpentyl)piperazin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 56550483 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-[3-[4-(5-pyrazol-1-ylpentyl)piperazin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCN(CCCCCn3cccn3)CC2)c1 |
| InChI | InChI=1S/C20H28N4O3S/c1-18(25)19-7-5-8-20(17-19)28(26,27)24-15-13-22(14-16-24)10-3-2-4-11-23-12-6-9-21-23/h5-9,12,17H,2-4,10-11,13-16H2,1H3 |
| InChIKey | UWBQYIBPYXLSSR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|