C19H27N5O5S — CID 56550328
1-(4-methoxy-3-nitrophenyl)sulfonyl-4-(5-pyrazol-1-ylpentyl)piperazine (PubChem CID 56550328) has the molecular formula C19H27N5O5S and a molecular weight of 437.52 g/mol. Its IUPAC name is 1-(4-methoxy-3-nitrophenyl)sulfonyl-4-(5-pyrazol-1-ylpentyl)piperazine.
| Compound Name | 1-(4-methoxy-3-nitrophenyl)sulfonyl-4-(5-pyrazol-1-ylpentyl)piperazine |
|---|---|
| PubChem CID | 56550328 |
| Molecular Formula | C19H27N5O5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-(4-methoxy-3-nitrophenyl)sulfonyl-4-(5-pyrazol-1-ylpentyl)piperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(CCCCCn3cccn3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H27N5O5S/c1-29-19-7-6-17(16-18(19)24(25)26)30(27,28)23-14-12-21(13-15-23)9-3-2-4-10-22-11-5-8-20-22/h5-8,11,16H,2-4,9-10,12-15H2,1H3 |
| InChIKey | KUDBSINWVKKIKD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|