C15H18F2N4O2S — CID 121094992
1-(3,5-difluorophenyl)sulfonyl-4-(2-pyrazol-1-ylethyl)piperazine (PubChem CID 121094992) has the molecular formula C15H18F2N4O2S and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)sulfonyl-4-(2-pyrazol-1-ylethyl)piperazine.
| Compound Name | 1-(3,5-difluorophenyl)sulfonyl-4-(2-pyrazol-1-ylethyl)piperazine |
|---|---|
| PubChem CID | 121094992 |
| Molecular Formula | C15H18F2N4O2S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-(3,5-difluorophenyl)sulfonyl-4-(2-pyrazol-1-ylethyl)piperazine |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)N1CCN(CCn2cccn2)CC1 |
| InChI | InChI=1S/C15H18F2N4O2S/c16-13-10-14(17)12-15(11-13)24(22,23)21-8-5-19(6-9-21)4-7-20-3-1-2-18-20/h1-3,10-12H,4-9H2 |
| InChIKey | FVMALVFAAMBOJR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |