C22H26N2O6S — CID 55996847
1-[3-[4-[2-(2-methoxyethoxy)benzoyl]piperazin-1-yl]sulfonylphenyl]ethanone (PubChem CID 55996847) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-[3-[4-[2-(2-methoxyethoxy)benzoyl]piperazin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[3-[4-[2-(2-methoxyethoxy)benzoyl]piperazin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 55996847 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-[3-[4-[2-(2-methoxyethoxy)benzoyl]piperazin-1-yl]sulfonylphenyl]ethanone |
| SMILES | COCCOc1ccccc1C(=O)N1CCN(S(=O)(=O)c2cccc(C(C)=O)c2)CC1 |
| InChI | InChI=1S/C22H26N2O6S/c1-17(25)18-6-5-7-19(16-18)31(27,28)24-12-10-23(11-13-24)22(26)20-8-3-4-9-21(20)30-15-14-29-2/h3-9,16H,10-15H2,1-2H3 |
| InChIKey | QFFGXWIUBLGHBV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|