C22H25N3O6S — CID 55633073
ethyl 6-[4-(3-acetylphenyl)sulfonylpiperazine-1-carbonyl]-2-methylpyridine-3-carboxylate (PubChem CID 55633073) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is ethyl 6-[4-(3-acetylphenyl)sulfonylpiperazine-1-carbonyl]-2-methylpyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(3-acetylphenyl)sulfonylpiperazine-1-carbonyl]-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 55633073 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | ethyl 6-[4-(3-acetylphenyl)sulfonylpiperazine-1-carbonyl]-2-methylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)N2CCN(S(=O)(=O)c3cccc(C(C)=O)c3)CC2)nc1C |
| InChI | InChI=1S/C22H25N3O6S/c1-4-31-22(28)19-8-9-20(23-15(19)2)21(27)24-10-12-25(13-11-24)32(29,30)18-7-5-6-17(14-18)16(3)26/h5-9,14H,4,10-13H2,1-3H3 |
| InChIKey | OBFNSGOHYYTLTE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |