C18H23F3N4O2S2 — CID 55721025
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide (PubChem CID 55721025) has the molecular formula C18H23F3N4O2S2 and a molecular weight of 448.54 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 55721025 |
| Molecular Formula | C18H23F3N4O2S2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
| SMILES | CN(CCCNC(=O)CSCc1nc2sc3c(c2c(=O)[nH]1)CCC3)CC(F)(F)F |
| InChI | InChI=1S/C18H23F3N4O2S2/c1-25(10-18(19,20)21)7-3-6-22-14(26)9-28-8-13-23-16(27)15-11-4-2-5-12(11)29-17(15)24-13/h2-10H2,1H3,(H,22,26)(H,23,24,27) |
| InChIKey | KLUFIZYGUXHOMN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|