C17H18BrN5O3 — CID 55721921
2-(2-bromo-4-cyano-6-ethoxyphenoxy)-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide (PubChem CID 55721921) has the molecular formula C17H18BrN5O3 and a molecular weight of 420.27 g/mol. Its IUPAC name is 2-(2-bromo-4-cyano-6-ethoxyphenoxy)-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide.
| Compound Name | 2-(2-bromo-4-cyano-6-ethoxyphenoxy)-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 55721921 |
| Molecular Formula | C17H18BrN5O3 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-(2-bromo-4-cyano-6-ethoxyphenoxy)-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
| SMILES | CCOc1cc(C#N)cc(Br)c1OCC(=O)NCCNc1ncccn1 |
| InChI | InChI=1S/C17H18BrN5O3/c1-2-25-14-9-12(10-19)8-13(18)16(14)26-11-15(24)20-6-7-23-17-21-4-3-5-22-17/h3-5,8-9H,2,6-7,11H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | KHBAUQZZTQPCME-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|