C18H23BrN2O4 — CID 75534322
2-(2-bromo-4-cyano-6-ethoxyphenoxy)-N-(4-hydroxy-4-methylcyclohexyl)acetamide (PubChem CID 75534322) has the molecular formula C18H23BrN2O4 and a molecular weight of 411.30 g/mol. Its IUPAC name is 2-(2-bromo-4-cyano-6-ethoxyphenoxy)-N-(4-hydroxy-4-methylcyclohexyl)acetamide.
| Compound Name | 2-(2-bromo-4-cyano-6-ethoxyphenoxy)-N-(4-hydroxy-4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 75534322 |
| Molecular Formula | C18H23BrN2O4 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-(2-bromo-4-cyano-6-ethoxyphenoxy)-N-(4-hydroxy-4-methylcyclohexyl)acetamide |
| SMILES | CCOc1cc(C#N)cc(Br)c1OCC(=O)NC1CCC(C)(O)CC1 |
| InChI | InChI=1S/C18H23BrN2O4/c1-3-24-15-9-12(10-20)8-14(19)17(15)25-11-16(22)21-13-4-6-18(2,23)7-5-13/h8-9,13,23H,3-7,11H2,1-2H3,(H,21,22) |
| InChIKey | RNWCWTTWRGYRRM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |