C27H28N4O4 — CID 55723831
N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 55723831) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55723831 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(CCNC(=O)c3ccc4c(c3)C(=O)N(CC3CCCO3)C4=O)cc2)n1 |
| InChI | InChI=1S/C27H28N4O4/c1-17-14-18(2)31(29-17)21-8-5-19(6-9-21)11-12-28-25(32)20-7-10-23-24(15-20)27(34)30(26(23)33)16-22-4-3-13-35-22/h5-10,14-15,22H,3-4,11-13,16H2,1-2H3,(H,28,32) |
| InChIKey | CCYVPMQRDUUCQD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|