C25H27F3N4O3 — CID 55728524
4-phenoxy-1-[4-[1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]butan-1-one (PubChem CID 55728524) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is 4-phenoxy-1-[4-[1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-phenoxy-1-[4-[1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55728524 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-phenoxy-1-[4-[1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]butan-1-one |
| SMILES | CC(c1nc(-c2cccc(C(F)(F)F)c2)no1)N1CCN(C(=O)CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C25H27F3N4O3/c1-18(24-29-23(30-35-24)19-7-5-8-20(17-19)25(26,27)28)31-12-14-32(15-13-31)22(33)11-6-16-34-21-9-3-2-4-10-21/h2-5,7-10,17-18H,6,11-16H2,1H3 |
| InChIKey | XYLCRLCRQWVFBL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|