C25H30N4O4S — CID 55728596
N-[[6-(diethylamino)-3-pyridinyl]methyl]-4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 55728596) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[[6-(diethylamino)-3-pyridinyl]methyl]-4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55728596 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)c2ccc(OC)c(S(=O)(=O)Nc3ccc(C)cc3)c2)cn1 |
| InChI | InChI=1S/C25H30N4O4S/c1-5-29(6-2)24-14-9-19(16-26-24)17-27-25(30)20-10-13-22(33-4)23(15-20)34(31,32)28-21-11-7-18(3)8-12-21/h7-16,28H,5-6,17H2,1-4H3,(H,27,30) |
| InChIKey | MQDXIIYVYDZXCM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |