C10H16O4 — CID 557312
ethyl 6-ethoxy-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 557312) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is ethyl 6-ethoxy-3,6-dihydro-2H-pyran-2-carboxylate.
| Compound Name | ethyl 6-ethoxy-3,6-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 557312 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethyl 6-ethoxy-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | CCOC(=O)C1CC=CC(OCC)O1 |
| InChI | InChI=1S/C10H16O4/c1-3-12-9-7-5-6-8(14-9)10(11)13-4-2/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | MIDREBZVVLEFIH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|