C23H21N5O4 — CID 55733151
1-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carbonitrile (PubChem CID 55733151) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 55733151 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cn(CC(=O)N2CCN(Cc3cccc4ccccc34)CC2)c1=O |
| InChI | InChI=1S/C23H21N5O4/c24-13-19-12-20(28(31)32)15-27(23(19)30)16-22(29)26-10-8-25(9-11-26)14-18-6-3-5-17-4-1-2-7-21(17)18/h1-7,12,15H,8-11,14,16H2 |
| InChIKey | ALGIGTWIMOPKJE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 112.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|