C23H21F2N3O3 — CID 55738794
3-[[4-(difluoromethoxy)phenyl]methylcarbamoylamino]-4-methyl-N-phenylbenzamide (PubChem CID 55738794) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)phenyl]methylcarbamoylamino]-4-methyl-N-phenylbenzamide.
| Compound Name | 3-[[4-(difluoromethoxy)phenyl]methylcarbamoylamino]-4-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 55738794 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[[4-(difluoromethoxy)phenyl]methylcarbamoylamino]-4-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2)cc1NC(=O)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H21F2N3O3/c1-15-7-10-17(21(29)27-18-5-3-2-4-6-18)13-20(15)28-23(30)26-14-16-8-11-19(12-9-16)31-22(24)25/h2-13,22H,14H2,1H3,(H,27,29)(H2,26,28,30) |
| InChIKey | ZPBMTPZMCNWSHY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |