C17H18BrN3OS — CID 55739001
2-[(4-bromothiophen-2-yl)methyl-methylamino]-N-(2-cyanoethyl)-N-phenylacetamide (PubChem CID 55739001) has the molecular formula C17H18BrN3OS and a molecular weight of 392.32 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl-methylamino]-N-(2-cyanoethyl)-N-phenylacetamide.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl-methylamino]-N-(2-cyanoethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 55739001 |
| Molecular Formula | C17H18BrN3OS |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl-methylamino]-N-(2-cyanoethyl)-N-phenylacetamide |
| SMILES | CN(CC(=O)N(CCC#N)c1ccccc1)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C17H18BrN3OS/c1-20(11-16-10-14(18)13-23-16)12-17(22)21(9-5-8-19)15-6-3-2-4-7-15/h2-4,6-7,10,13H,5,9,11-12H2,1H3 |
| InChIKey | WSWWZSPQXFNWIQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |