C23H31N3O5S — CID 55741388
1-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-[1-(3-propan-2-yloxyphenyl)ethyl]urea (PubChem CID 55741388) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is 1-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-[1-(3-propan-2-yloxyphenyl)ethyl]urea.
| Compound Name | 1-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-[1-(3-propan-2-yloxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55741388 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 1-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-[1-(3-propan-2-yloxyphenyl)ethyl]urea |
| SMILES | CC(C)Oc1cccc(C(C)NC(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C23H31N3O5S/c1-17(2)31-21-6-4-5-20(15-21)18(3)25-23(27)24-16-19-7-9-22(10-8-19)32(28,29)26-11-13-30-14-12-26/h4-10,15,17-18H,11-14,16H2,1-3H3,(H2,24,25,27) |
| InChIKey | KTZSJXSAAFTHGF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |