C24H29N3O6S — CID 55589999
1-[1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-3-[(4-morpholin-4-ylsulfonylphenyl)methyl]urea (PubChem CID 55589999) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-3-[(4-morpholin-4-ylsulfonylphenyl)methyl]urea.
| Compound Name | 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-3-[(4-morpholin-4-ylsulfonylphenyl)methyl]urea |
|---|---|
| PubChem CID | 55589999 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-[1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-3-[(4-morpholin-4-ylsulfonylphenyl)methyl]urea |
| SMILES | CCOc1cccc2cc(C(C)NC(=O)NCc3ccc(S(=O)(=O)N4CCOCC4)cc3)oc12 |
| InChI | InChI=1S/C24H29N3O6S/c1-3-32-21-6-4-5-19-15-22(33-23(19)21)17(2)26-24(28)25-16-18-7-9-20(10-8-18)34(29,30)27-11-13-31-14-12-27/h4-10,15,17H,3,11-14,16H2,1-2H3,(H2,25,26,28) |
| InChIKey | GKPBKKOMAFSYGS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |