C18H20Cl2N4O4 — CID 55743155
N-(3,4-dichlorophenyl)-2-[[6-(2-methoxyethoxy)-3-pyridinyl]carbamoyl-methylamino]acetamide (PubChem CID 55743155) has the molecular formula C18H20Cl2N4O4 and a molecular weight of 427.29 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[[6-(2-methoxyethoxy)-3-pyridinyl]carbamoyl-methylamino]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[[6-(2-methoxyethoxy)-3-pyridinyl]carbamoyl-methylamino]acetamide |
|---|---|
| PubChem CID | 55743155 |
| Molecular Formula | C18H20Cl2N4O4 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[[6-(2-methoxyethoxy)-3-pyridinyl]carbamoyl-methylamino]acetamide |
| SMILES | COCCOc1ccc(NC(=O)N(C)CC(=O)Nc2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C18H20Cl2N4O4/c1-24(11-16(25)22-12-3-5-14(19)15(20)9-12)18(26)23-13-4-6-17(21-10-13)28-8-7-27-2/h3-6,9-10H,7-8,11H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | HQVVYDQOMUAWQT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|