C22H27FN4O — CID 55744895
N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55744895) has the molecular formula C22H27FN4O and a molecular weight of 382.48 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55744895 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C)n(CC(C)CNC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)n1 |
| InChI | InChI=1S/C22H27FN4O/c1-14(13-26-16(3)10-15(2)25-26)12-24-22(28)21-11-17(4)27(18(21)5)20-8-6-19(23)7-9-20/h6-11,14H,12-13H2,1-5H3,(H,24,28) |
| InChIKey | WNBPUWPSUFKTJK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|