C21H29F3N4O3 — CID 55746276
1-[2-(4-tert-butylphenoxy)ethyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]urea (PubChem CID 55746276) has the molecular formula C21H29F3N4O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenoxy)ethyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]urea.
| Compound Name | 1-[2-(4-tert-butylphenoxy)ethyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]urea |
|---|---|
| PubChem CID | 55746276 |
| Molecular Formula | C21H29F3N4O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-[2-(4-tert-butylphenoxy)ethyl]-3-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]urea |
| SMILES | Cn1ccnc1C(O)(CCNC(=O)NCCOc1ccc(C(C)(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H29F3N4O3/c1-19(2,3)15-5-7-16(8-6-15)31-14-12-27-18(29)26-10-9-20(30,21(22,23)24)17-25-11-13-28(17)4/h5-8,11,13,30H,9-10,12,14H2,1-4H3,(H2,26,27,29) |
| InChIKey | AOJSCAUYADHZMV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|