C24H22N4O4S — CID 55750977
N-[4-oxo-4-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)anilino]butyl]thiophene-3-carboxamide (PubChem CID 55750977) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[4-oxo-4-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)anilino]butyl]thiophene-3-carboxamide.
| Compound Name | N-[4-oxo-4-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)anilino]butyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55750977 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[4-oxo-4-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)anilino]butyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)Nc1ccc(C(=O)N2CC(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H22N4O4S/c29-21(6-3-12-25-23(31)17-11-13-33-15-17)26-18-9-7-16(8-10-18)24(32)28-14-22(30)27-19-4-1-2-5-20(19)28/h1-2,4-5,7-11,13,15H,3,6,12,14H2,(H,25,31)(H,26,29)(H,27,30) |
| InChIKey | FSKVDHHNMBJCIH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|