C26H23ClN4O4 — CID 55750719
4-chloro-N-[4-oxo-4-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)anilino]butyl]benzamide (PubChem CID 55750719) has the molecular formula C26H23ClN4O4 and a molecular weight of 490.95 g/mol. Its IUPAC name is 4-chloro-N-[4-oxo-4-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)anilino]butyl]benzamide.
| Compound Name | 4-chloro-N-[4-oxo-4-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)anilino]butyl]benzamide |
|---|---|
| PubChem CID | 55750719 |
| Molecular Formula | C26H23ClN4O4 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-chloro-N-[4-oxo-4-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)anilino]butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)Nc1ccc(C(=O)N2CC(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H23ClN4O4/c27-19-11-7-17(8-12-19)25(34)28-15-3-6-23(32)29-20-13-9-18(10-14-20)26(35)31-16-24(33)30-21-4-1-2-5-22(21)31/h1-2,4-5,7-14H,3,6,15-16H2,(H,28,34)(H,29,32)(H,30,33) |
| InChIKey | XEVXIASBCRRVRO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|