C23H19ClN2O2S — CID 55751872
2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-[3-(cyanomethoxy)phenyl]acetamide (PubChem CID 55751872) has the molecular formula C23H19ClN2O2S and a molecular weight of 422.94 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-[3-(cyanomethoxy)phenyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-[3-(cyanomethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 55751872 |
| Molecular Formula | C23H19ClN2O2S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-[(4-chlorophenyl)-phenylmethyl]sulfanyl-N-[3-(cyanomethoxy)phenyl]acetamide |
| SMILES | N#CCOc1cccc(NC(=O)CSC(c2ccccc2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H19ClN2O2S/c24-19-11-9-18(10-12-19)23(17-5-2-1-3-6-17)29-16-22(27)26-20-7-4-8-21(15-20)28-14-13-25/h1-12,15,23H,14,16H2,(H,26,27) |
| InChIKey | MKNUNYMRIKHMOJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |