C23H25N3O4 — CID 55754589
[3-(benzylcarbamoyl)phenyl] 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)butanoate (PubChem CID 55754589) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is [3-(benzylcarbamoyl)phenyl] 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)butanoate.
| Compound Name | [3-(benzylcarbamoyl)phenyl] 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)butanoate |
|---|---|
| PubChem CID | 55754589 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [3-(benzylcarbamoyl)phenyl] 4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)butanoate |
| SMILES | CC(C)c1noc(CCCC(=O)Oc2cccc(C(=O)NCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C23H25N3O4/c1-16(2)22-25-20(30-26-22)12-7-13-21(27)29-19-11-6-10-18(14-19)23(28)24-15-17-8-4-3-5-9-17/h3-6,8-11,14,16H,7,12-13,15H2,1-2H3,(H,24,28) |
| InChIKey | ACPMSTXRVMXHJH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|