C23H19N3O4S — CID 55549622
[3-(benzylcarbamoyl)phenyl] 3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanoate (PubChem CID 55549622) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is [3-(benzylcarbamoyl)phenyl] 3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanoate.
| Compound Name | [3-(benzylcarbamoyl)phenyl] 3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 55549622 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [3-(benzylcarbamoyl)phenyl] 3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanoate |
| SMILES | O=C(CCc1nnc(-c2ccsc2)o1)Oc1cccc(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H19N3O4S/c27-21(10-9-20-25-26-23(30-20)18-11-12-31-15-18)29-19-8-4-7-17(13-19)22(28)24-14-16-5-2-1-3-6-16/h1-8,11-13,15H,9-10,14H2,(H,24,28) |
| InChIKey | JYTDJINJJISBBW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|