C19H20N4O4S — CID 56528840
[3-(propylcarbamoylamino)phenyl] 3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanoate (PubChem CID 56528840) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is [3-(propylcarbamoylamino)phenyl] 3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanoate.
| Compound Name | [3-(propylcarbamoylamino)phenyl] 3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 56528840 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [3-(propylcarbamoylamino)phenyl] 3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanoate |
| SMILES | CCCNC(=O)Nc1cccc(OC(=O)CCc2nnc(-c3ccsc3)o2)c1 |
| InChI | InChI=1S/C19H20N4O4S/c1-2-9-20-19(25)21-14-4-3-5-15(11-14)26-17(24)7-6-16-22-23-18(27-16)13-8-10-28-12-13/h3-5,8,10-12H,2,6-7,9H2,1H3,(H2,20,21,25) |
| InChIKey | YZKQBTRTVMRQOH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|