C19H19N3O4S — CID 167918274
[3-(propylcarbamoylamino)phenyl] 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)acetate (PubChem CID 167918274) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is [3-(propylcarbamoylamino)phenyl] 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)acetate.
| Compound Name | [3-(propylcarbamoylamino)phenyl] 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 167918274 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [3-(propylcarbamoylamino)phenyl] 2-(2-thiophen-2-yl-1,3-oxazol-4-yl)acetate |
| SMILES | CCCNC(=O)Nc1cccc(OC(=O)Cc2coc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C19H19N3O4S/c1-2-8-20-19(24)22-13-5-3-6-15(10-13)26-17(23)11-14-12-25-18(21-14)16-7-4-9-27-16/h3-7,9-10,12H,2,8,11H2,1H3,(H2,20,22,24) |
| InChIKey | HLDKCKGVWZEGON-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|