C25H24N2O2S — CID 55757012
1-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-oxo-N-(2-phenylethyl)quinoline-4-carboxamide (PubChem CID 55757012) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-oxo-N-(2-phenylethyl)quinoline-4-carboxamide.
| Compound Name | 1-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-oxo-N-(2-phenylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 55757012 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-oxo-N-(2-phenylethyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(CN(CCc2ccccc2)C(=O)c2cc(=O)n(C)c3ccccc23)s1 |
| InChI | InChI=1S/C25H24N2O2S/c1-18-12-13-20(30-18)17-27(15-14-19-8-4-3-5-9-19)25(29)22-16-24(28)26(2)23-11-7-6-10-21(22)23/h3-13,16H,14-15,17H2,1-2H3 |
| InChIKey | HJKMBHRSXGNHOX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |