C25H29N3O5S — CID 55759796
3-methoxy-4-[4-oxo-4-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)butoxy]benzonitrile (PubChem CID 55759796) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is 3-methoxy-4-[4-oxo-4-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)butoxy]benzonitrile.
| Compound Name | 3-methoxy-4-[4-oxo-4-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)butoxy]benzonitrile |
|---|---|
| PubChem CID | 55759796 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 3-methoxy-4-[4-oxo-4-(6-pyrrolidin-1-ylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)butoxy]benzonitrile |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)N1CCCc2cc(S(=O)(=O)N3CCCC3)ccc21 |
| InChI | InChI=1S/C25H29N3O5S/c1-32-24-16-19(18-26)8-11-23(24)33-15-5-7-25(29)28-14-4-6-20-17-21(9-10-22(20)28)34(30,31)27-12-2-3-13-27/h8-11,16-17H,2-7,12-15H2,1H3 |
| InChIKey | RMWWYLAIAVJNHV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|