C19H17BrN2O5S — CID 26891996
(4-cyano-2-methoxyphenyl) 2-bromo-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 26891996) has the molecular formula C19H17BrN2O5S and a molecular weight of 465.33 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 2-bromo-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (4-cyano-2-methoxyphenyl) 2-bromo-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 26891996 |
| Molecular Formula | C19H17BrN2O5S |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 2-bromo-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1cc(C#N)ccc1OC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Br |
| InChI | InChI=1S/C19H17BrN2O5S/c1-26-18-10-13(12-21)4-7-17(18)27-19(23)15-11-14(5-6-16(15)20)28(24,25)22-8-2-3-9-22/h4-7,10-11H,2-3,8-9H2,1H3 |
| InChIKey | NGDWWGLDYYPWCB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|