C25H27N3O2 — CID 55761158
N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-2-(N-methylanilino)benzamide (PubChem CID 55761158) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-2-(N-methylanilino)benzamide.
| Compound Name | N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-2-(N-methylanilino)benzamide |
|---|---|
| PubChem CID | 55761158 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[3-[[acetyl(ethyl)amino]methyl]phenyl]-2-(N-methylanilino)benzamide |
| SMILES | CCN(Cc1cccc(NC(=O)c2ccccc2N(C)c2ccccc2)c1)C(C)=O |
| InChI | InChI=1S/C25H27N3O2/c1-4-28(19(2)29)18-20-11-10-12-21(17-20)26-25(30)23-15-8-9-16-24(23)27(3)22-13-6-5-7-14-22/h5-17H,4,18H2,1-3H3,(H,26,30) |
| InChIKey | WZAFFKQDAICARO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |