C26H32N4O2 — CID 55762459
1-methyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-2-oxoquinoline-4-carboxamide (PubChem CID 55762459) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-methyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-2-oxoquinoline-4-carboxamide.
| Compound Name | 1-methyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55762459 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 1-methyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-2-oxoquinoline-4-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCC(C)NC(=O)c3cc(=O)n(C)c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C26H32N4O2/c1-19-7-6-8-21(17-19)30-15-13-29(14-16-30)12-11-20(2)27-26(32)23-18-25(31)28(3)24-10-5-4-9-22(23)24/h4-10,17-18,20H,11-16H2,1-3H3,(H,27,32) |
| InChIKey | HWBWBPHHCMESNW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |